C10H14F3N3O5 — CID 155902905
(5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-2-(2,2,2-trifluoroethylimino)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one (PubChem CID 155902905) has the molecular formula C10H14F3N3O5 and a molecular weight of 313.23 g/mol. Its IUPAC name is (5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-2-(2,2,2-trifluoroethylimino)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one.
| Compound Name | (5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-2-(2,2,2-trifluoroethylimino)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one |
|---|---|
| PubChem CID | 155902905 |
| Molecular Formula | C10H14F3N3O5 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-2-(2,2,2-trifluoroethylimino)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one |
| SMILES | O=C1/C(=N/CC(F)(F)F)N[C@@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)N12 |
| InChI | InChI=1S/C10H14F3N3O5/c11-10(12,13)2-14-7-9(21)16-3(1-17)4(18)5(19)6(20)8(16)15-7/h3-6,8,17-20H,1-2H2,(H,14,15)/t3-,4-,5+,6+,8+/m1/s1 |
| InChIKey | BTJLUXJFINSUEU-WIKBCIAESA-N |
| XLogP | -2.84 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|