C18H19N3O — CID 155902994
1-[2-(3,5-dimethylpyrazol-1-yl)ethyliminomethyl]naphthalen-2-ol (PubChem CID 155902994) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylpyrazol-1-yl)ethyliminomethyl]naphthalen-2-ol.
| Compound Name | 1-[2-(3,5-dimethylpyrazol-1-yl)ethyliminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 155902994 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-[2-(3,5-dimethylpyrazol-1-yl)ethyliminomethyl]naphthalen-2-ol |
| SMILES | Cc1cc(C)n(CC/N=C/c2c(O)ccc3ccccc23)n1 |
| InChI | InChI=1S/C18H19N3O/c1-13-11-14(2)21(20-13)10-9-19-12-17-16-6-4-3-5-15(16)7-8-18(17)22/h3-8,11-12,22H,9-10H2,1-2H3/b19-12+ |
| InChIKey | HKMDKEFCYISIEE-XDHOZWIPSA-N |
| XLogP | 3.48 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|