C28H25N9O2S2 — CID 155903094
4-[5-methyl-4-[2-(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)-3-phenyl-3,4-dihydropyrazol-5-yl]triazol-1-yl]benzenesulfonamide (PubChem CID 155903094) has the molecular formula C28H25N9O2S2 and a molecular weight of 583.70 g/mol. Its IUPAC name is 4-[5-methyl-4-[2-(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)-3-phenyl-3,4-dihydropyrazol-5-yl]triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-methyl-4-[2-(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)-3-phenyl-3,4-dihydropyrazol-5-yl]triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155903094 |
| Molecular Formula | C28H25N9O2S2 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 4-[5-methyl-4-[2-(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)-3-phenyl-3,4-dihydropyrazol-5-yl]triazol-1-yl]benzenesulfonamide |
| SMILES | Cc1nc(N2N=C(c3nnn(-c4ccc(S(N)(=O)=O)cc4)c3C)CC2c2ccccc2)sc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C28H25N9O2S2/c1-18-27(33-31-21-11-7-4-8-12-21)40-28(30-18)37-25(20-9-5-3-6-10-20)17-24(34-37)26-19(2)36(35-32-26)22-13-15-23(16-14-22)41(29,38)39/h3-16,25H,17H2,1-2H3,(H2,29,38,39)/b33-31+ |
| InChIKey | QBUBCTDDTDSCEO-QOSDPKFLSA-N |
| XLogP | 5.76 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|