C19H21O5- — CID 155903261
(1R,3R,6S,7E,10S,12R)-3,10,12-trimethyl-9,13,15-trioxo-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-trien-17-olate (PubChem CID 155903261) has the molecular formula C19H21O5- and a molecular weight of 329.37 g/mol. Its IUPAC name is (1R,3R,6S,7E,10S,12R)-3,10,12-trimethyl-9,13,15-trioxo-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-trien-17-olate.
| Compound Name | (1R,3R,6S,7E,10S,12R)-3,10,12-trimethyl-9,13,15-trioxo-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-trien-17-olate |
|---|---|
| PubChem CID | 155903261 |
| Molecular Formula | C19H21O5- |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (1R,3R,6S,7E,10S,12R)-3,10,12-trimethyl-9,13,15-trioxo-16-oxatricyclo[12.2.1.01,6]heptadeca-4,7,14(17)-trien-17-olate |
| SMILES | C[C@@H]1C[C@H](C)C(=O)/C=C\[C@@H]2C=C[C@H](C)C[C@@]23OC(=O)C(=C3[O-])C1=O |
| InChI | InChI=1S/C19H22O5/c1-10-4-5-13-6-7-14(20)11(2)8-12(3)16(21)15-17(22)19(13,9-10)24-18(15)23/h4-7,10-13,22H,8-9H2,1-3H3/p-1/b7-6-/t10-,11-,12+,13-,19+/m0/s1 |
| InChIKey | OWDPBNOVKXSRIH-QTMSVPCBSA-M |
| XLogP | 1.48 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|