C19H26N6OS — CID 155903315
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2,3,3a,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 155903315) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2,3,3a,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2,3,3a,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 155903315 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2,3,3a,6,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | O=C1C2CNNC2CCN1CCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C19H26N6OS/c26-19-15-13-20-21-16(15)5-6-25(19)12-9-23-7-10-24(11-8-23)18-14-3-1-2-4-17(14)27-22-18/h1-4,15-16,20-21H,5-13H2 |
| InChIKey | KNABMQOLWSELFL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |