About (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride
(3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (PubChem CID 155904885) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride |
| PubChem CID | 155904885 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride |
| SMILES | Cl.N[C@@H]1CCc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C10H11NO2.ClH/c11-9-4-3-6-1-2-7(10(12)13)5-8(6)9;/h1-2,5,9H,3-4,11H2,(H,12,13);1H/t9-;/m1./s1 |
| InChIKey | XIBHQJRIPHWZEW-SBSPUUFOSA-N |
| XLogP | 1.75 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The IUPAC name of (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (CID 155904885) is (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride.
What is the SMILES notation for (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The canonical SMILES for (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride is Cl.N[C@@H]1CCc2ccc(C(=O)O)cc21.
What is the InChIKey of (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The InChIKey is XIBHQJRIPHWZEW-SBSPUUFOSA-N. The full InChI is InChI=1S/C10H11NO2.ClH/c11-9-4-3-6-1-2-7(10(12)13)5-8(6)9;/h1-2,5,9H,3-4,11H2,(H,12,13);1H/t9-;/m1./s1.
What are the key properties of (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
(3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride has a molecular weight of 213.66 g/mol, XLogP of 1.75, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 155904885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).