C19H33N3O4 — CID 155905518
tert-butyl (3S,4R)-3-acetamido-3-(tert-butylcarbamoyl)-4-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 155905518) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-acetamido-3-(tert-butylcarbamoyl)-4-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-acetamido-3-(tert-butylcarbamoyl)-4-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155905518 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | tert-butyl (3S,4R)-3-acetamido-3-(tert-butylcarbamoyl)-4-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1CN(C(=O)OC(C)(C)C)C[C@]1(NC(C)=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H33N3O4/c1-9-10-14-11-22(16(25)26-18(6,7)8)12-19(14,20-13(2)23)15(24)21-17(3,4)5/h9,14H,1,10-12H2,2-8H3,(H,20,23)(H,21,24)/t14-,19-/m1/s1 |
| InChIKey | PSNFRMXIQNDKLS-AUUYWEPGSA-N |
| XLogP | 2.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|