About ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate
ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate (PubChem CID 155905554) has the molecular formula C14H16BrNO4
and a molecular weight of 342.19 g/mol. Its IUPAC name is ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate.
Molecular Properties
| Compound Name | ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate |
| PubChem CID | 155905554 |
| Molecular Formula | C14H16BrNO4 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CC2(C[C@@H](O)c3cc(Br)ccc3O2)C1 |
| InChI | InChI=1S/C14H16BrNO4/c1-2-19-13(18)16-7-14(8-16)6-11(17)10-5-9(15)3-4-12(10)20-14/h3-5,11,17H,2,6-8H2,1H3/t11-/m1/s1 |
| InChIKey | JKFHUVPEBSWVIT-LLVKDONJSA-N |
| XLogP | 2.48 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate?
The IUPAC name of ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate (CID 155905554) is ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate.
What is the SMILES notation for ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate?
The canonical SMILES for ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate is CCOC(=O)N1CC2(C[C@@H](O)c3cc(Br)ccc3O2)C1.
What is the InChIKey of ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate?
The InChIKey is JKFHUVPEBSWVIT-LLVKDONJSA-N. The full InChI is InChI=1S/C14H16BrNO4/c1-2-19-13(18)16-7-14(8-16)6-11(17)10-5-9(15)3-4-12(10)20-14/h3-5,11,17H,2,6-8H2,1H3/t11-/m1/s1.
What are the key properties of ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate?
ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate has a molecular weight of 342.19 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R)-6-bromo-4-hydroxyspiro[3,4-dihydrochromene-2,3'-azetidine]-1'-carboxylate is sourced from PubChem (CID 155905554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).