About 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde
4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde (PubChem CID 155906575) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde |
| PubChem CID | 155906575 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(C=O)cc(C)c1Nc1ccnc(N)n1 |
| InChI | InChI=1S/C13H14N4O/c1-8-5-10(7-18)6-9(2)12(8)16-11-3-4-15-13(14)17-11/h3-7H,1-2H3,(H3,14,15,16,17) |
| InChIKey | GXHAXIWOIPYVPJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde?
The IUPAC name of 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde (CID 155906575) is 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde.
What is the SMILES notation for 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde?
The canonical SMILES for 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde is Cc1cc(C=O)cc(C)c1Nc1ccnc(N)n1.
What is the InChIKey of 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde?
The InChIKey is GXHAXIWOIPYVPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O/c1-8-5-10(7-18)6-9(2)12(8)16-11-3-4-15-13(14)17-11/h3-7H,1-2H3,(H3,14,15,16,17).
What are the key properties of 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde?
4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde has a molecular weight of 242.28 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-aminopyrimidin-4-yl)amino]-3,5-dimethylbenzaldehyde is sourced from PubChem (CID 155906575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).