C17H27O5PS — CID 15590660
2-methoxy-7-[methoxy(propylsulfanyl)phosphoryl]oxy-2,4,4-trimethyl-3H-chromene (PubChem CID 15590660) has the molecular formula C17H27O5PS and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-methoxy-7-[methoxy(propylsulfanyl)phosphoryl]oxy-2,4,4-trimethyl-3H-chromene.
| Compound Name | 2-methoxy-7-[methoxy(propylsulfanyl)phosphoryl]oxy-2,4,4-trimethyl-3H-chromene |
|---|---|
| PubChem CID | 15590660 |
| Molecular Formula | C17H27O5PS |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-methoxy-7-[methoxy(propylsulfanyl)phosphoryl]oxy-2,4,4-trimethyl-3H-chromene |
| SMILES | CCCSP(=O)(OC)Oc1ccc2c(c1)OC(C)(OC)CC2(C)C |
| InChI | InChI=1S/C17H27O5PS/c1-7-10-24-23(18,20-6)22-13-8-9-14-15(11-13)21-17(4,19-5)12-16(14,2)3/h8-9,11H,7,10,12H2,1-6H3 |
| InChIKey | KVMPTQNCDCWOTQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|