About 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone
2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone (PubChem CID 155907008) has the molecular formula C8H4Br2Cl2O
and a molecular weight of 346.83 g/mol. Its IUPAC name is 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone |
| PubChem CID | 155907008 |
| Molecular Formula | C8H4Br2Cl2O |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 343.80 |
| IUPAC Name | 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone |
| SMILES | O=C(c1ccccc1Br)C(Cl)(Cl)Br |
| InChI | InChI=1S/C8H4Br2Cl2O/c9-6-4-2-1-3-5(6)7(13)8(10,11)12/h1-4H |
| InChIKey | JONRWYPGCPYUNE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone?
The IUPAC name of 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone (CID 155907008) is 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone.
What is the SMILES notation for 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone?
The canonical SMILES for 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone is O=C(c1ccccc1Br)C(Cl)(Cl)Br.
What is the InChIKey of 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone?
The InChIKey is JONRWYPGCPYUNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2Cl2O/c9-6-4-2-1-3-5(6)7(13)8(10,11)12/h1-4H.
What are the key properties of 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone?
2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone has a molecular weight of 346.83 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(2-bromophenyl)-2,2-dichloroethanone is sourced from PubChem (CID 155907008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).