About 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one
8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one (PubChem CID 155907017) has the molecular formula C10H8N2O4
and a molecular weight of 220.18 g/mol. Its IUPAC name is 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one.
Molecular Properties
| Compound Name | 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one |
| PubChem CID | 155907017 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one |
| SMILES | [H]/N=C1\C(=O)C=C(O)c2c(O)cc(O)c(N)c21 |
| InChI | InChI=1S/C10H8N2O4/c11-9-5(15)1-3(13)7-4(14)2-6(16)10(12)8(7)9/h1-2,11,13-14,16H,12H2/b11-9+ |
| InChIKey | LQIQKFKFMZKPRG-PKNBQFBNSA-N |
| XLogP | 0.53 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one?
The IUPAC name of 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one (CID 155907017) is 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one.
What is the SMILES notation for 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one?
The canonical SMILES for 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one is [H]/N=C1\C(=O)C=C(O)c2c(O)cc(O)c(N)c21.
What is the InChIKey of 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one?
The InChIKey is LQIQKFKFMZKPRG-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H8N2O4/c11-9-5(15)1-3(13)7-4(14)2-6(16)10(12)8(7)9/h1-2,11,13-14,16H,12H2/b11-9+.
What are the key properties of 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one?
8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one has a molecular weight of 220.18 g/mol, XLogP of 0.53, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-4,5,7-trihydroxy-1-iminonaphthalen-2-one is sourced from PubChem (CID 155907017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).