C25H18BrF4P — CID 155907097
bromo-triphenyl-[(2,3,5,6-tetrafluorophenyl)methyl]-λ5-phosphane (PubChem CID 155907097) has the molecular formula C25H18BrF4P and a molecular weight of 505.29 g/mol. Its IUPAC name is bromo-triphenyl-[(2,3,5,6-tetrafluorophenyl)methyl]-λ5-phosphane.
| Compound Name | bromo-triphenyl-[(2,3,5,6-tetrafluorophenyl)methyl]-λ5-phosphane |
|---|---|
| PubChem CID | 155907097 |
| Molecular Formula | C25H18BrF4P |
| Molecular Weight | 505.29 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | bromo-triphenyl-[(2,3,5,6-tetrafluorophenyl)methyl]-λ5-phosphane |
| SMILES | Fc1cc(F)c(F)c(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c1F |
| InChI | InChI=1S/C25H18BrF4P/c26-31(18-10-4-1-5-11-18,19-12-6-2-7-13-19,20-14-8-3-9-15-20)17-21-24(29)22(27)16-23(28)25(21)30/h1-16H,17H2 |
| InChIKey | YGKASKYPQSHSAF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.29 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|