About [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride
[3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride (PubChem CID 155907816) has the molecular formula C16H22ClNO3
and a molecular weight of 311.81 g/mol. Its IUPAC name is [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride.
Molecular Properties
| Compound Name | [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride |
| PubChem CID | 155907816 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1cccc(C2(C(C)=O)CCN(C)CC2)c1.Cl |
| InChI | InChI=1S/C16H21NO3.ClH/c1-12(18)16(7-9-17(3)10-8-16)14-5-4-6-15(11-14)20-13(2)19;/h4-6,11H,7-10H2,1-3H3;1H |
| InChIKey | SPPGJSZRCRLGOO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride?
The IUPAC name of [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride (CID 155907816) is [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride.
What is the SMILES notation for [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride?
The canonical SMILES for [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride is CC(=O)Oc1cccc(C2(C(C)=O)CCN(C)CC2)c1.Cl.
What is the InChIKey of [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride?
The InChIKey is SPPGJSZRCRLGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3.ClH/c1-12(18)16(7-9-17(3)10-8-16)14-5-4-6-15(11-14)20-13(2)19;/h4-6,11H,7-10H2,1-3H3;1H.
What are the key properties of [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride?
[3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride has a molecular weight of 311.81 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-acetyl-1-methylpiperidin-4-yl)phenyl] acetate;hydrochloride is sourced from PubChem (CID 155907816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).