C31H28N2O4 — CID 155907998
methyl (2R)-2-(4-benzamidophenyl)-2-[(4-methylbenzoyl)amino]-3-phenylpropanoate (PubChem CID 155907998) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is methyl (2R)-2-(4-benzamidophenyl)-2-[(4-methylbenzoyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-(4-benzamidophenyl)-2-[(4-methylbenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 155907998 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | methyl (2R)-2-(4-benzamidophenyl)-2-[(4-methylbenzoyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@](Cc1ccccc1)(NC(=O)c1ccc(C)cc1)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28N2O4/c1-22-13-15-25(16-14-22)29(35)33-31(30(36)37-2,21-23-9-5-3-6-10-23)26-17-19-27(20-18-26)32-28(34)24-11-7-4-8-12-24/h3-20H,21H2,1-2H3,(H,32,34)(H,33,35)/t31-/m1/s1 |
| InChIKey | BBEAKUIJTHGOPP-WJOKGBTCSA-N |
| XLogP | 5.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |