About (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate
(3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate (PubChem CID 155908216) has the molecular formula C15H28O3Si
and a molecular weight of 284.47 g/mol. Its IUPAC name is (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate.
Molecular Properties
| Compound Name | (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate |
| PubChem CID | 155908216 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate |
| SMILES | CC(=O)OCC(O[Si](C)(C)C)C(C)=CCC=C(C)C |
| InChI | InChI=1S/C15H28O3Si/c1-12(2)9-8-10-13(3)15(11-17-14(4)16)18-19(5,6)7/h9-10,15H,8,11H2,1-7H3 |
| InChIKey | UMXASTJSQGQEKV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate?
The IUPAC name of (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate (CID 155908216) is (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate.
What is the SMILES notation for (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate?
The canonical SMILES for (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate is CC(=O)OCC(O[Si](C)(C)C)C(C)=CCC=C(C)C.
What is the InChIKey of (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate?
The InChIKey is UMXASTJSQGQEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3Si/c1-12(2)9-8-10-13(3)15(11-17-14(4)16)18-19(5,6)7/h9-10,15H,8,11H2,1-7H3.
What are the key properties of (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate?
(3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate has a molecular weight of 284.47 g/mol, XLogP of 4.07, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-dimethyl-2-trimethylsilyloxyocta-3,6-dienyl) acetate is sourced from PubChem (CID 155908216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).