About 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione
5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione (PubChem CID 155908365) has the molecular formula C18H32N2O2
and a molecular weight of 308.47 g/mol. Its IUPAC name is 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione.
Molecular Properties
| Compound Name | 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione |
| PubChem CID | 155908365 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione |
| SMILES | CC(=O)C(C)CCCC(C)=CCCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C18H32N2O2/c1-15(7-5-9-16(2)17(3)21)8-6-10-18(22)20-13-11-19(4)12-14-20/h8,16H,5-7,9-14H2,1-4H3 |
| InChIKey | QMADJUVVKFXMDJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione?
The IUPAC name of 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione (CID 155908365) is 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione.
What is the SMILES notation for 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione?
The canonical SMILES for 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione is CC(=O)C(C)CCCC(C)=CCCC(=O)N1CCN(C)CC1.
What is the InChIKey of 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione?
The InChIKey is QMADJUVVKFXMDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O2/c1-15(7-5-9-16(2)17(3)21)8-6-10-18(22)20-13-11-19(4)12-14-20/h8,16H,5-7,9-14H2,1-4H3.
What are the key properties of 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione?
5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione has a molecular weight of 308.47 g/mol, XLogP of 2.88, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dimethyl-1-(4-methylpiperazin-1-yl)undec-4-ene-1,10-dione is sourced from PubChem (CID 155908365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).