About 4-methoxy-2-methylocta-1,3-diene
4-methoxy-2-methylocta-1,3-diene (PubChem CID 155908408) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 4-methoxy-2-methylocta-1,3-diene.
Molecular Properties
| Compound Name | 4-methoxy-2-methylocta-1,3-diene |
| PubChem CID | 155908408 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 4-methoxy-2-methylocta-1,3-diene |
| SMILES | C=C(C)C=C(CCCC)OC |
| InChI | InChI=1S/C10H18O/c1-5-6-7-10(11-4)8-9(2)3/h8H,2,5-7H2,1,3-4H3 |
| InChIKey | LRUTXLRHMKGBCN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2-methylocta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-methylocta-1,3-diene?
The IUPAC name of 4-methoxy-2-methylocta-1,3-diene (CID 155908408) is 4-methoxy-2-methylocta-1,3-diene.
What is the SMILES notation for 4-methoxy-2-methylocta-1,3-diene?
The canonical SMILES for 4-methoxy-2-methylocta-1,3-diene is C=C(C)C=C(CCCC)OC.
What is the InChIKey of 4-methoxy-2-methylocta-1,3-diene?
The InChIKey is LRUTXLRHMKGBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-5-6-7-10(11-4)8-9(2)3/h8H,2,5-7H2,1,3-4H3.
What are the key properties of 4-methoxy-2-methylocta-1,3-diene?
4-methoxy-2-methylocta-1,3-diene has a molecular weight of 154.25 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-methylocta-1,3-diene is sourced from PubChem (CID 155908408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).