C14H16N2O — CID 155908488
1,3,8-trimethyl-2-oxido-3,4-dihydropyrazino[1,2-a]indol-2-ium (PubChem CID 155908488) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 1,3,8-trimethyl-2-oxido-3,4-dihydropyrazino[1,2-a]indol-2-ium.
| Compound Name | 1,3,8-trimethyl-2-oxido-3,4-dihydropyrazino[1,2-a]indol-2-ium |
|---|---|
| PubChem CID | 155908488 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1,3,8-trimethyl-2-oxido-3,4-dihydropyrazino[1,2-a]indol-2-ium |
| SMILES | CC1=[N+]([O-])C(C)Cn2c1cc1cc(C)ccc12 |
| InChI | InChI=1S/C14H16N2O/c1-9-4-5-13-12(6-9)7-14-11(3)16(17)10(2)8-15(13)14/h4-7,10H,8H2,1-3H3 |
| InChIKey | NVZUGNJQQLUAMA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 31.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|