C21H18Br2N4O3 — CID 155908595
1,7-bis[(3-bromophenyl)methyl]-8-(hydroxymethyl)-3-methylpurine-2,6-dione (PubChem CID 155908595) has the molecular formula C21H18Br2N4O3 and a molecular weight of 534.21 g/mol. Its IUPAC name is 1,7-bis[(3-bromophenyl)methyl]-8-(hydroxymethyl)-3-methylpurine-2,6-dione.
| Compound Name | 1,7-bis[(3-bromophenyl)methyl]-8-(hydroxymethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 155908595 |
| Molecular Formula | C21H18Br2N4O3 |
| Molecular Weight | 534.21 g/mol |
| Exact Mass | 531.97 |
| IUPAC Name | 1,7-bis[(3-bromophenyl)methyl]-8-(hydroxymethyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2cccc(Br)c2)c(=O)c2c1nc(CO)n2Cc1cccc(Br)c1 |
| InChI | InChI=1S/C21H18Br2N4O3/c1-25-19-18(20(29)27(21(25)30)11-14-5-3-7-16(23)9-14)26(17(12-28)24-19)10-13-4-2-6-15(22)8-13/h2-9,28H,10-12H2,1H3 |
| InChIKey | VBKHIRNMZQTJFD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |