C24H24N+ — CID 155908650
1-methyl-4-[(E)-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethenyl]pyridin-1-ium (PubChem CID 155908650) has the molecular formula C24H24N+ and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-methyl-4-[(E)-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethenyl]pyridin-1-ium.
| Compound Name | 1-methyl-4-[(E)-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 155908650 |
| Molecular Formula | C24H24N+ |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-methyl-4-[(E)-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethenyl]pyridin-1-ium |
| SMILES | C[n+]1ccc(/C=C/c2cc3ccc2CCc2ccc(cc2)CC3)cc1 |
| InChI | InChI=1S/C24H24N/c1-25-16-14-21(15-17-25)9-13-24-18-22-7-6-19-2-4-20(5-3-19)8-11-23(24)12-10-22/h2-5,9-10,12-18H,6-8,11H2,1H3/q+1/b13-9+ |
| InChIKey | CLJDCMSNXAXWQY-UKTHLTGXSA-N |
| XLogP | 4.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|