C33H20F3N3 — CID 155908963
2-[2,6-bis[2-(5-fluoro-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine (PubChem CID 155908963) has the molecular formula C33H20F3N3 and a molecular weight of 515.54 g/mol. Its IUPAC name is 2-[2,6-bis[2-(5-fluoro-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine.
| Compound Name | 2-[2,6-bis[2-(5-fluoro-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine |
|---|---|
| PubChem CID | 155908963 |
| Molecular Formula | C33H20F3N3 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 2-[2,6-bis[2-(5-fluoro-2-pyridinyl)phenyl]phenyl]-5-fluoropyridine |
| SMILES | Fc1ccc(-c2ccccc2-c2cccc(-c3ccccc3-c3ccc(F)cn3)c2-c2ccc(F)cn2)nc1 |
| InChI | InChI=1S/C33H20F3N3/c34-21-12-15-30(37-18-21)26-8-3-1-6-24(26)28-10-5-11-29(33(28)32-17-14-23(36)20-39-32)25-7-2-4-9-27(25)31-16-13-22(35)19-38-31/h1-20H |
| InChIKey | BQHVRAVJOVFJLA-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |