C23H28N4O3 — CID 155910084
3-cyclopropyl-N-[[(1S,5S,6R,7R)-3-(4,6-dimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-5-carboxamide (PubChem CID 155910084) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-cyclopropyl-N-[[(1S,5S,6R,7R)-3-(4,6-dimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-[[(1S,5S,6R,7R)-3-(4,6-dimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 155910084 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-cyclopropyl-N-[[(1S,5S,6R,7R)-3-(4,6-dimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C)nc(N2C[C@@H]3[C@H](CNC(=O)c4cc(C5CC5)no4)[C@H]4CC[C@]3(C2)O4)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-13-7-14(2)25-21(8-13)27-11-17-16(19-5-6-23(17,12-27)29-19)10-24-22(28)20-9-18(26-30-20)15-3-4-15/h7-9,15-17,19H,3-6,10-12H2,1-2H3,(H,24,28)/t16-,17+,19+,23+/m0/s1 |
| InChIKey | RCVSGWZWWLLWKO-UVELEOGVSA-N |
| XLogP | 2.98 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |