C18H27N3OS — CID 155910366
(6S,7R)-7-methyl-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-1-one (PubChem CID 155910366) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is (6S,7R)-7-methyl-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-1-one.
| Compound Name | (6S,7R)-7-methyl-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 155910366 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (6S,7R)-7-methyl-8-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2,8-diazaspiro[5.5]undecan-1-one |
| SMILES | C[C@H]1N(Cc2nc3c(s2)CCCC3)CCC[C@@]12CCCNC2=O |
| InChI | InChI=1S/C18H27N3OS/c1-13-18(8-4-10-19-17(18)22)9-5-11-21(13)12-16-20-14-6-2-3-7-15(14)23-16/h13H,2-12H2,1H3,(H,19,22)/t13-,18+/m1/s1 |
| InChIKey | VJHROTLZFFNACP-ACJLOTCBSA-N |
| XLogP | 2.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |