C13H11FN4 — CID 155911122
3-(2,5-dimethyl-1,2,4-triazol-3-yl)-5-fluoroquinoline (PubChem CID 155911122) has the molecular formula C13H11FN4 and a molecular weight of 242.26 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1,2,4-triazol-3-yl)-5-fluoroquinoline.
| Compound Name | 3-(2,5-dimethyl-1,2,4-triazol-3-yl)-5-fluoroquinoline |
|---|---|
| PubChem CID | 155911122 |
| Molecular Formula | C13H11FN4 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-(2,5-dimethyl-1,2,4-triazol-3-yl)-5-fluoroquinoline |
| SMILES | Cc1nc(-c2cnc3cccc(F)c3c2)n(C)n1 |
| InChI | InChI=1S/C13H11FN4/c1-8-16-13(18(2)17-8)9-6-10-11(14)4-3-5-12(10)15-7-9/h3-7H,1-2H3 |
| InChIKey | WNBWRIWFJBJGID-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |