C16H13NOS — CID 155911185
5-(2,3-dihydro-1-benzofuran-6-yl)-2-methyl-1,3-benzothiazole (PubChem CID 155911185) has the molecular formula C16H13NOS and a molecular weight of 267.35 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-6-yl)-2-methyl-1,3-benzothiazole.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-6-yl)-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 155911185 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-6-yl)-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2cc(-c3ccc4c(c3)OCC4)ccc2s1 |
| InChI | InChI=1S/C16H13NOS/c1-10-17-14-8-12(4-5-16(14)19-10)13-3-2-11-6-7-18-15(11)9-13/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | OFHHETUBAYFZEB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |