C37H44FN7O6 — CID 155911501
13-[2-(2-fluorophenyl)acetyl]-6,7,8-trimethoxy-16-(1-methylpyrazole-4-carbonyl)-1,3,13,16,20-pentazatetracyclo[20.3.1.02,11.04,9]hexacosa-2,4,6,8,10-pentaen-19-one (PubChem CID 155911501) has the molecular formula C37H44FN7O6 and a molecular weight of 701.80 g/mol. Its IUPAC name is 13-[2-(2-fluorophenyl)acetyl]-6,7,8-trimethoxy-16-(1-methylpyrazole-4-carbonyl)-1,3,13,16,20-pentazatetracyclo[20.3.1.02,11.04,9]hexacosa-2,4,6,8,10-pentaen-19-one.
| Compound Name | 13-[2-(2-fluorophenyl)acetyl]-6,7,8-trimethoxy-16-(1-methylpyrazole-4-carbonyl)-1,3,13,16,20-pentazatetracyclo[20.3.1.02,11.04,9]hexacosa-2,4,6,8,10-pentaen-19-one |
|---|---|
| PubChem CID | 155911501 |
| Molecular Formula | C37H44FN7O6 |
| Molecular Weight | 701.80 g/mol |
| Exact Mass | 701.33 |
| IUPAC Name | 13-[2-(2-fluorophenyl)acetyl]-6,7,8-trimethoxy-16-(1-methylpyrazole-4-carbonyl)-1,3,13,16,20-pentazatetracyclo[20.3.1.02,11.04,9]hexacosa-2,4,6,8,10-pentaen-19-one |
| SMILES | COc1cc2nc3c(cc2c(OC)c1OC)CN(C(=O)Cc1ccccc1F)CCN(C(=O)c1cnn(C)c1)CCC(=O)NCC1CCCN3C1 |
| InChI | InChI=1S/C37H44FN7O6/c1-42-22-27(20-40-42)37(48)43-13-11-32(46)39-19-24-8-7-12-45(21-24)36-26(16-28-30(41-36)18-31(49-2)35(51-4)34(28)50-3)23-44(15-14-43)33(47)17-25-9-5-6-10-29(25)38/h5-6,9-10,16,18,20,22,24H,7-8,11-15,17,19,21,23H2,1-4H3,(H,39,46) |
| InChIKey | HSMACPXCXLKHQS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |