C11H15N3O2S2 — CID 155911897
N-[2-[2-(5-methylthiophen-2-yl)imidazol-1-yl]ethyl]methanesulfonamide (PubChem CID 155911897) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[2-[2-(5-methylthiophen-2-yl)imidazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-(5-methylthiophen-2-yl)imidazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 155911897 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[2-[2-(5-methylthiophen-2-yl)imidazol-1-yl]ethyl]methanesulfonamide |
| SMILES | Cc1ccc(-c2nccn2CCNS(C)(=O)=O)s1 |
| InChI | InChI=1S/C11H15N3O2S2/c1-9-3-4-10(17-9)11-12-5-7-14(11)8-6-13-18(2,15)16/h3-5,7,13H,6,8H2,1-2H3 |
| InChIKey | WYDXKLQPPGGPQA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |