C12H11N3OS — CID 155911948
4-[1-[2-(furan-2-yl)ethyl]imidazol-2-yl]-1,2-thiazole (PubChem CID 155911948) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 4-[1-[2-(furan-2-yl)ethyl]imidazol-2-yl]-1,2-thiazole.
| Compound Name | 4-[1-[2-(furan-2-yl)ethyl]imidazol-2-yl]-1,2-thiazole |
|---|---|
| PubChem CID | 155911948 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-[1-[2-(furan-2-yl)ethyl]imidazol-2-yl]-1,2-thiazole |
| SMILES | c1coc(CCn2ccnc2-c2cnsc2)c1 |
| InChI | InChI=1S/C12H11N3OS/c1-2-11(16-7-1)3-5-15-6-4-13-12(15)10-8-14-17-9-10/h1-2,4,6-9H,3,5H2 |
| InChIKey | GAOMPDQTHJMCIT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |