C28H27ClN2O5 — CID 155912065
(2R,6S)-4-[2-(2-chlorophenyl)acetyl]-14-hydroxy-18-methoxy-16-oxa-4,7-diazatetracyclo[15.3.1.111,15.02,6]docosa-1(21),11(22),12,14,17,19-hexaen-8-one (PubChem CID 155912065) has the molecular formula C28H27ClN2O5 and a molecular weight of 506.99 g/mol. Its IUPAC name is (2R,6S)-4-[2-(2-chlorophenyl)acetyl]-14-hydroxy-18-methoxy-16-oxa-4,7-diazatetracyclo[15.3.1.111,15.02,6]docosa-1(21),11(22),12,14,17,19-hexaen-8-one.
| Compound Name | (2R,6S)-4-[2-(2-chlorophenyl)acetyl]-14-hydroxy-18-methoxy-16-oxa-4,7-diazatetracyclo[15.3.1.111,15.02,6]docosa-1(21),11(22),12,14,17,19-hexaen-8-one |
|---|---|
| PubChem CID | 155912065 |
| Molecular Formula | C28H27ClN2O5 |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | (2R,6S)-4-[2-(2-chlorophenyl)acetyl]-14-hydroxy-18-methoxy-16-oxa-4,7-diazatetracyclo[15.3.1.111,15.02,6]docosa-1(21),11(22),12,14,17,19-hexaen-8-one |
| SMILES | COc1ccc2cc1Oc1cc(ccc1O)CCC(=O)N[C@@H]1CN(C(=O)Cc3ccccc3Cl)C[C@@H]21 |
| InChI | InChI=1S/C28H27ClN2O5/c1-35-24-10-8-18-13-26(24)36-25-12-17(6-9-23(25)32)7-11-27(33)30-22-16-31(15-20(18)22)28(34)14-19-4-2-3-5-21(19)29/h2-6,8-10,12-13,20,22,32H,7,11,14-16H2,1H3,(H,30,33)/t20-,22+/m0/s1 |
| InChIKey | UHJAWIFLAHVMCS-RBBKRZOGSA-N |
| XLogP | 4.45 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |