C21H23N3O3 — CID 155912601
[(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]-(5-methoxy-3-methyl-1H-indol-2-yl)methanone (PubChem CID 155912601) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]-(5-methoxy-3-methyl-1H-indol-2-yl)methanone.
| Compound Name | [(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]-(5-methoxy-3-methyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 155912601 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]-(5-methoxy-3-methyl-1H-indol-2-yl)methanone |
| SMILES | COc1ccc2[nH]c(C(=O)N3C[C@@H](Cc4ccccn4)[C@H](O)C3)c(C)c2c1 |
| InChI | InChI=1S/C21H23N3O3/c1-13-17-10-16(27-2)6-7-18(17)23-20(13)21(26)24-11-14(19(25)12-24)9-15-5-3-4-8-22-15/h3-8,10,14,19,23,25H,9,11-12H2,1-2H3/t14-,19-/m1/s1 |
| InChIKey | RIEHAUNOJJJMOJ-AUUYWEPGSA-N |
| XLogP | 2.56 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|