C15H21N3O5S2 — CID 155913167
N-[(1R,2R,4S)-4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-2-hydroxycyclopentyl]-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 155913167) has the molecular formula C15H21N3O5S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[(1R,2R,4S)-4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-2-hydroxycyclopentyl]-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1R,2R,4S)-4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-2-hydroxycyclopentyl]-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155913167 |
| Molecular Formula | C15H21N3O5S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[(1R,2R,4S)-4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)-2-hydroxycyclopentyl]-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)N[C@@H]2C[C@H](C(=O)N3CCS(=O)(=O)CC3)C[C@H]2O)cs1 |
| InChI | InChI=1S/C15H21N3O5S2/c1-9-16-12(8-24-9)14(20)17-11-6-10(7-13(11)19)15(21)18-2-4-25(22,23)5-3-18/h8,10-11,13,19H,2-7H2,1H3,(H,17,20)/t10-,11+,13+/m0/s1 |
| InChIKey | BQTACGBUGCTJOL-DMDPSCGWSA-N |
| XLogP | -0.42 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |