About 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole
2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole (PubChem CID 155913855) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole |
| PubChem CID | 155913855 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole |
| SMILES | c1coc(-c2nccn2[C@@H]2C[C@H]3OCC[C@@H]23)c1 |
| InChI | InChI=1S/C13H14N2O2/c1-2-11(16-6-1)13-14-4-5-15(13)10-8-12-9(10)3-7-17-12/h1-2,4-6,9-10,12H,3,7-8H2/t9-,10+,12+/m0/s1 |
| InChIKey | CNTCNEYBMXSKEN-HOSYDEDBSA-N |
| XLogP | 2.49 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole?
The IUPAC name of 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole (CID 155913855) is 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole.
What is the SMILES notation for 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole?
The canonical SMILES for 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole is c1coc(-c2nccn2[C@@H]2C[C@H]3OCC[C@@H]23)c1.
What is the InChIKey of 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole?
The InChIKey is CNTCNEYBMXSKEN-HOSYDEDBSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-2-11(16-6-1)13-14-4-5-15(13)10-8-12-9(10)3-7-17-12/h1-2,4-6,9-10,12H,3,7-8H2/t9-,10+,12+/m0/s1.
What are the key properties of 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole?
2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole has a molecular weight of 230.27 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-1-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]imidazole is sourced from PubChem (CID 155913855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).