C21H23N3O — CID 155914642
2-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]benzonitrile (PubChem CID 155914642) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]benzonitrile.
| Compound Name | 2-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 155914642 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-[[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCN2[C@@H](COC[C@@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C21H23N3O/c22-12-18-8-4-5-9-19(18)13-23-10-11-24-20(14-23)15-25-16-21(24)17-6-2-1-3-7-17/h1-9,20-21H,10-11,13-16H2/t20-,21-/m1/s1 |
| InChIKey | WTBIMNFZAPBJAI-NHCUHLMSSA-N |
| XLogP | 2.82 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |