C12H11N3S — CID 155914940
2-methyl-5-(1-methylpyrazol-3-yl)-1,3-benzothiazole (PubChem CID 155914940) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-methyl-5-(1-methylpyrazol-3-yl)-1,3-benzothiazole.
| Compound Name | 2-methyl-5-(1-methylpyrazol-3-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 155914940 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-methyl-5-(1-methylpyrazol-3-yl)-1,3-benzothiazole |
| SMILES | Cc1nc2cc(-c3ccn(C)n3)ccc2s1 |
| InChI | InChI=1S/C12H11N3S/c1-8-13-11-7-9(3-4-12(11)16-8)10-5-6-15(2)14-10/h3-7H,1-2H3 |
| InChIKey | NURSAVZRWXVHSG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |