C16H21NO4 — CID 155915771
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2,5-dimethylphenyl)acetamide (PubChem CID 155915771) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2,5-dimethylphenyl)acetamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 155915771 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(CC(=O)N[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)c1 |
| InChI | InChI=1S/C16H21NO4/c1-9-3-4-10(2)11(5-9)6-14(19)17-12-7-20-16-13(18)8-21-15(12)16/h3-5,12-13,15-16,18H,6-8H2,1-2H3,(H,17,19)/t12-,13-,15-,16-/m1/s1 |
| InChIKey | PVJPIMQCRDXNLD-RRCSTGOVSA-N |
| XLogP | 0.49 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |