About (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone
(3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone (PubChem CID 15591628) has the molecular formula C14H11NOS
and a molecular weight of 241.31 g/mol. Its IUPAC name is (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone |
| PubChem CID | 15591628 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone |
| SMILES | Cc1csc2[nH]cc(C(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C14H11NOS/c1-9-8-17-14-12(9)11(7-15-14)13(16)10-5-3-2-4-6-10/h2-8,15H,1H3 |
| InChIKey | TYOQDEZZRSQYLK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone?
The IUPAC name of (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone (CID 15591628) is (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone.
What is the SMILES notation for (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone?
The canonical SMILES for (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone is Cc1csc2[nH]cc(C(=O)c3ccccc3)c12.
What is the InChIKey of (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone?
The InChIKey is TYOQDEZZRSQYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NOS/c1-9-8-17-14-12(9)11(7-15-14)13(16)10-5-3-2-4-6-10/h2-8,15H,1H3.
What are the key properties of (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone?
(3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone has a molecular weight of 241.31 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-6H-thieno[2,3-b]pyrrol-4-yl)-phenylmethanone is sourced from PubChem (CID 15591628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).