C22H29N5O — CID 155917339
[4-(2,3-dihydro-1H-inden-2-yl)-1,4-diazepan-1-yl]-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)methanone (PubChem CID 155917339) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is [4-(2,3-dihydro-1H-inden-2-yl)-1,4-diazepan-1-yl]-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)methanone.
| Compound Name | [4-(2,3-dihydro-1H-inden-2-yl)-1,4-diazepan-1-yl]-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)methanone |
|---|---|
| PubChem CID | 155917339 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | [4-(2,3-dihydro-1H-inden-2-yl)-1,4-diazepan-1-yl]-(6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepin-2-yl)methanone |
| SMILES | O=C(c1cn2c(n1)CCNCC2)N1CCCN(C2Cc3ccccc3C2)CC1 |
| InChI | InChI=1S/C22H29N5O/c28-22(20-16-27-11-8-23-7-6-21(27)24-20)26-10-3-9-25(12-13-26)19-14-17-4-1-2-5-18(17)15-19/h1-2,4-5,16,19,23H,3,6-15H2 |
| InChIKey | KLMJGCUHKLGBFB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |