C16H25N3O6 — CID 155917393
5-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1-methylpyrimidine-2,4-dione (PubChem CID 155917393) has the molecular formula C16H25N3O6 and a molecular weight of 355.39 g/mol. Its IUPAC name is 5-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155917393 |
| Molecular Formula | C16H25N3O6 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 5-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]-1-methylpyrimidine-2,4-dione |
| SMILES | COCCC[C@@]1(CO)CN(C(=O)c2cn(C)c(=O)[nH]c2=O)CC[C@H]1O |
| InChI | InChI=1S/C16H25N3O6/c1-18-8-11(13(22)17-15(18)24)14(23)19-6-4-12(21)16(9-19,10-20)5-3-7-25-2/h8,12,20-21H,3-7,9-10H2,1-2H3,(H,17,22,24)/t12-,16+/m1/s1 |
| InChIKey | UFNZXDPCJFKUIL-WBMJQRKESA-N |
| XLogP | -1.31 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|