About 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline
2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline (PubChem CID 155917397) has the molecular formula C15H16N4O
and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline.
Molecular Properties
| Compound Name | 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline |
| PubChem CID | 155917397 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline |
| SMILES | CCCn1ncnc1-c1cc2ccccc2nc1OC |
| InChI | InChI=1S/C15H16N4O/c1-3-8-19-14(16-10-17-19)12-9-11-6-4-5-7-13(11)18-15(12)20-2/h4-7,9-10H,3,8H2,1-2H3 |
| InChIKey | ATRDGPSLWQVRCK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline?
The IUPAC name of 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline (CID 155917397) is 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline.
What is the SMILES notation for 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline?
The canonical SMILES for 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline is CCCn1ncnc1-c1cc2ccccc2nc1OC.
What is the InChIKey of 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline?
The InChIKey is ATRDGPSLWQVRCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O/c1-3-8-19-14(16-10-17-19)12-9-11-6-4-5-7-13(11)18-15(12)20-2/h4-7,9-10H,3,8H2,1-2H3.
What are the key properties of 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline?
2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline has a molecular weight of 268.32 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(2-propyl-1,2,4-triazol-3-yl)quinoline is sourced from PubChem (CID 155917397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).