C12H21N5OS — CID 155917501
5-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 155917501) has the molecular formula C12H21N5OS and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 155917501 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 5-[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCC[C@H]1COC[C@H]2CN(c3nnc(N)s3)CCN12 |
| InChI | InChI=1S/C12H21N5OS/c1-2-3-9-7-18-8-10-6-16(4-5-17(9)10)12-15-14-11(13)19-12/h9-10H,2-8H2,1H3,(H2,13,14)/t9-,10+/m0/s1 |
| InChIKey | RTBZTYCLQABNJO-VHSXEESVSA-N |
| XLogP | 0.81 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |