C15H16FN3O4 — CID 155918078
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-fluoro-7-methylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 155918078) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-fluoro-7-methylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-fluoro-7-methylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155918078 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-fluoro-7-methylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1ccn2c(F)c(C(=O)N[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)nc2c1 |
| InChI | InChI=1S/C15H16FN3O4/c1-7-2-3-19-10(4-7)18-11(14(19)16)15(21)17-8-5-22-13-9(20)6-23-12(8)13/h2-4,8-9,12-13,20H,5-6H2,1H3,(H,17,21)/t8-,9-,12-,13-/m1/s1 |
| InChIKey | NTRNBPFGVRXAKC-NRMKKVEVSA-N |
| XLogP | 0.04 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |