About methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate
methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate (PubChem CID 155918484) has the molecular formula C19H29NO3
and a molecular weight of 319.44 g/mol. Its IUPAC name is methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate.
Molecular Properties
| Compound Name | methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate |
| PubChem CID | 155918484 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate |
| SMILES | COC(=O)CCCN1C[C@@H](c2ccccc2)O[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C19H29NO3/c1-19(2,3)17-14-20(12-8-11-18(21)22-4)13-16(23-17)15-9-6-5-7-10-15/h5-7,9-10,16-17H,8,11-14H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | CBGGOVKSDZVPGL-DLBZAZTESA-N |
| XLogP | 3.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate?
The IUPAC name of methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate (CID 155918484) is methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate.
What is the SMILES notation for methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate?
The canonical SMILES for methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate is COC(=O)CCCN1C[C@@H](c2ccccc2)O[C@@H](C(C)(C)C)C1.
What is the InChIKey of methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate?
The InChIKey is CBGGOVKSDZVPGL-DLBZAZTESA-N. The full InChI is InChI=1S/C19H29NO3/c1-19(2,3)17-14-20(12-8-11-18(21)22-4)13-16(23-17)15-9-6-5-7-10-15/h5-7,9-10,16-17H,8,11-14H2,1-4H3/t16-,17+/m0/s1.
What are the key properties of methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate?
methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate has a molecular weight of 319.44 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2S,6R)-2-tert-butyl-6-phenylmorpholin-4-yl]butanoate is sourced from PubChem (CID 155918484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).