C22H25FN2O3 — CID 155919294
ethyl (3aR,4R,5S,7aR)-2-[(8-fluoro-4-oxo-1H-quinolin-2-yl)methyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 155919294) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is ethyl (3aR,4R,5S,7aR)-2-[(8-fluoro-4-oxo-1H-quinolin-2-yl)methyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aR,4R,5S,7aR)-2-[(8-fluoro-4-oxo-1H-quinolin-2-yl)methyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 155919294 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | ethyl (3aR,4R,5S,7aR)-2-[(8-fluoro-4-oxo-1H-quinolin-2-yl)methyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2CN(Cc3cc(=O)c4cccc(F)c4[nH]3)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C22H25FN2O3/c1-3-28-22(27)20-13(2)7-8-14-10-25(12-17(14)20)11-15-9-19(26)16-5-4-6-18(23)21(16)24-15/h4-9,13-14,17,20H,3,10-12H2,1-2H3,(H,24,26)/t13-,14-,17+,20+/m0/s1 |
| InChIKey | FOXDROILLPBBBU-WBFDFMGXSA-N |
| XLogP | 3.10 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|