C18H16FN3O2 — CID 155919581
N-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]-3-phenoxypropanamide (PubChem CID 155919581) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]-3-phenoxypropanamide.
| Compound Name | N-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 155919581 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)Nc1[nH]ncc1-c1cccc(F)c1 |
| InChI | InChI=1S/C18H16FN3O2/c19-14-6-4-5-13(11-14)16-12-20-22-18(16)21-17(23)9-10-24-15-7-2-1-3-8-15/h1-8,11-12H,9-10H2,(H2,20,21,22,23) |
| InChIKey | ORXDGAASNJEZFI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |