About 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one
3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one (PubChem CID 155919966) has the molecular formula C16H10F2N2O2
and a molecular weight of 300.26 g/mol. Its IUPAC name is 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one.
Molecular Properties
| Compound Name | 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one |
| PubChem CID | 155919966 |
| Molecular Formula | C16H10F2N2O2 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one |
| SMILES | O=c1c(/C=N/Nc2cc(F)ccc2F)coc2ccccc12 |
| InChI | InChI=1S/C16H10F2N2O2/c17-11-5-6-13(18)14(7-11)20-19-8-10-9-22-15-4-2-1-3-12(15)16(10)21/h1-9,20H/b19-8+ |
| InChIKey | WFRCEMZAZUXQGA-UFWORHAWSA-N |
| XLogP | 3.52 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one?
The IUPAC name of 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one (CID 155919966) is 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one.
What is the SMILES notation for 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one?
The canonical SMILES for 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one is O=c1c(/C=N/Nc2cc(F)ccc2F)coc2ccccc12.
What is the InChIKey of 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one?
The InChIKey is WFRCEMZAZUXQGA-UFWORHAWSA-N. The full InChI is InChI=1S/C16H10F2N2O2/c17-11-5-6-13(18)14(7-11)20-19-8-10-9-22-15-4-2-1-3-12(15)16(10)21/h1-9,20H/b19-8+.
What are the key properties of 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one?
3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one has a molecular weight of 300.26 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-[(2,5-difluorophenyl)hydrazinylidene]methyl]chromen-4-one is sourced from PubChem (CID 155919966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).