C19H19FN2O3S — CID 155920011
3-fluoro-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)benzamide (PubChem CID 155920011) has the molecular formula C19H19FN2O3S and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-fluoro-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)benzamide.
| Compound Name | 3-fluoro-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 155920011 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3-fluoro-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)benzamide |
| SMILES | O=C(NS(=O)(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cccc(F)c1 |
| InChI | InChI=1S/C19H19FN2O3S/c20-15-7-1-6-14(11-15)19(23)22-26(24,25)21-18-16-8-2-4-12(16)10-13-5-3-9-17(13)18/h1,6-7,10-11,21H,2-5,8-9H2,(H,22,23) |
| InChIKey | KKBDMFZEDUJTMS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |