C20H19F3N2O3S — CID 155920044
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)-3-(trifluoromethyl)benzamide (PubChem CID 155920044) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155920044 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylsulfamoyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NS(=O)(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O3S/c21-20(22,23)15-7-1-6-14(11-15)19(26)25-29(27,28)24-18-16-8-2-4-12(16)10-13-5-3-9-17(13)18/h1,6-7,10-11,24H,2-5,8-9H2,(H,25,26) |
| InChIKey | DGIBDMRBGBZGGL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |