About 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine
4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine (PubChem CID 155920140) has the molecular formula C15H15N3O
and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine |
| PubChem CID | 155920140 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine |
| SMILES | Cc1oc2ccc(-c3cc(N)nc(N)c3)cc2c1C |
| InChI | InChI=1S/C15H15N3O/c1-8-9(2)19-13-4-3-10(5-12(8)13)11-6-14(16)18-15(17)7-11/h3-7H,1-2H3,(H4,16,17,18) |
| InChIKey | PZRAWCBVDRNTDQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine?
The IUPAC name of 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine (CID 155920140) is 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine.
What is the SMILES notation for 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine?
The canonical SMILES for 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine is Cc1oc2ccc(-c3cc(N)nc(N)c3)cc2c1C.
What is the InChIKey of 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine?
The InChIKey is PZRAWCBVDRNTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O/c1-8-9(2)19-13-4-3-10(5-12(8)13)11-6-14(16)18-15(17)7-11/h3-7H,1-2H3,(H4,16,17,18).
What are the key properties of 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine?
4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine has a molecular weight of 253.30 g/mol, XLogP of 3.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethyl-1-benzofuran-5-yl)pyridine-2,6-diamine is sourced from PubChem (CID 155920140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).