C18H26O4 — CID 155920167
(1R,2R,5R,6S)-3-(hydroxymethyl)-4-[(1E,3E,5E)-undeca-1,3,5-trienyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol (PubChem CID 155920167) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (1R,2R,5R,6S)-3-(hydroxymethyl)-4-[(1E,3E,5E)-undeca-1,3,5-trienyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol.
| Compound Name | (1R,2R,5R,6S)-3-(hydroxymethyl)-4-[(1E,3E,5E)-undeca-1,3,5-trienyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
|---|---|
| PubChem CID | 155920167 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (1R,2R,5R,6S)-3-(hydroxymethyl)-4-[(1E,3E,5E)-undeca-1,3,5-trienyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
| SMILES | CCCCC/C=C/C=C/C=C/C1=C(CO)[C@@H](O)[C@H]2O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C18H26O4/c1-2-3-4-5-6-7-8-9-10-11-13-14(12-19)16(21)18-17(22-18)15(13)20/h6-11,15-21H,2-5,12H2,1H3/b7-6+,9-8+,11-10+/t15-,16-,17+,18-/m1/s1 |
| InChIKey | NEZJYHIPHBNQKX-LXTDKRKVSA-N |
| XLogP | 2.03 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|